CAS 1201944-89-9 is the registry number for 2-(Bis(methylthio)methylene)-5,6-dimethoxy-1H-indene-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
2-[bis(methylsulfanyl)methylidene]-5,6-dimethoxyindene-1,3-dione (CAS 1201944-89-9) is a chemical compound with the molecular formula C14H14O4S2 and a molecular weight of 310.4 g/mol. IUPAC name: 2-[bis(methylsulfanyl)methylidene]-5,6-dimethoxyindene-1,3-dione. InChIKey: AFXMLEQHFISFRS-UHFFFAOYSA-N.
| Molecular formula | C14H14O4S2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-[bis(methylsulfanyl)methylidene]-5,6-dimethoxyindene-1,3-dione |
| InChIKey | AFXMLEQHFISFRS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=C(SC)SC)C2=O)OC |
Computed by PubChem (NCBI)