Products 120205-58-5
CAS 120205-58-5 appears in our catalog under these names: Monomethyl auristatin E intermediate–9, Monomethyl auristatin E intermediate-9, Monomethyl auristatin E intermediate-9, 98.75%, (3R,4S,5S)-Tert-butyl 4-(((benzyloxy)carbonyl)(methyl)amino)-3-methoxy-5-methylheptanoate, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 5 mg, 10 mg.
Tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]heptanoate (CAS 120205-58-5) is a chemical compound with the molecular formula C22H35NO5 and a molecular weight of 393.5 g/mol. IUPAC name: tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]heptanoate. InChIKey: PCUHBNWYHLQSBO-HQRMLTQVSA-N.
| Molecular formula | C22H35NO5 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]heptanoate |
| InChIKey | PCUHBNWYHLQSBO-HQRMLTQVSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
Monomethyl auristatin E intermediate-9