CAS 1202054-12-3 appears in our catalog under these names: 5-Trifluoromethyl-1h-pyrazol-4-ylboronic acid, 98%, (5–(Trifluoromethyl)–1H–pyrazol–4–yl)boronic acid, (5-(Trifluoromethyl)-1H-pyrazol-4-yl)boronic acid 95%, (5-(Trifluoromethyl)-1H-pyrazol-4-yl)boronic acid, 97%, 97%, (5-(Trifluoromethyl)-1H-pyrazol-4-yl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
[5-(trifluoromethyl)-1H-pyrazol-4-yl]boronic acid (CAS 1202054-12-3) is a chemical compound with the molecular formula C4H4BF3N2O2 and a molecular weight of 179.90 g/mol. IUPAC name: [5-(trifluoromethyl)-1H-pyrazol-4-yl]boronic acid. InChIKey: XJZGCUKCAPHOBU-UHFFFAOYSA-N.
| Molecular formula | C4H4BF3N2O2 |
|---|---|
| Molecular weight | 179.90 g/mol |
| IUPAC name | [5-(trifluoromethyl)-1H-pyrazol-4-yl]boronic acid |
| InChIKey | XJZGCUKCAPHOBU-UHFFFAOYSA-N |
| SMILES | B(C1=C(NN=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)