Products 1202168-64-6
CAS 1202168-64-6 is the registry number for 2-(4-Methylphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone (CAS 1202168-64-6) is a chemical compound with the molecular formula C18H20O4 and a molecular weight of 300.3 g/mol. IUPAC name: 2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone. InChIKey: KBGCVAVPHOWSCM-UHFFFAOYSA-N.
| Molecular formula | C18H20O4 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone |
| InChIKey | KBGCVAVPHOWSCM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(=O)C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)