CAS 83088-26-0 appears in our catalog under these names: (E)-3,3',4,5'-Tetramethoxystilbene, 95%, 3,3',4,5'–Tetramethoxypiceatannol, 3,3',4,5'-Tetramethoxypiceatannol, >98.0%(GC), (E)-4-(3,5-Dimethoxystyryl)-1,2-dimethoxybenzene 97%, (E)-4-(3,5-Dimethoxystyryl)-1,2-dimethoxybenzene, 99%, 99%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 200mg, 5g.
1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene (CAS 83088-26-0) is a chemical compound with the molecular formula C18H20O4 and a molecular weight of 300.3 g/mol. IUPAC name: 1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene. InChIKey: PTVAOGIYBMTHSN-AATRIKPKSA-N.
| Molecular formula | C18H20O4 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene |
| InChIKey | PTVAOGIYBMTHSN-AATRIKPKSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)OC)OC |
Computed by PubChem (NCBI)