Products 120218-98-6
CAS 120218-98-6 is the registry number for JCP-170. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-chloro-3-methoxy-1-oxoisochromen-7-yl)-2,2-diphenylacetamide (CAS 120218-98-6) is a chemical compound with the molecular formula C24H18ClNO4 and a molecular weight of 419.9 g/mol. IUPAC name: N-(4-chloro-3-methoxy-1-oxoisochromen-7-yl)-2,2-diphenylacetamide. InChIKey: VKHWNOVUTPMVHV-UHFFFAOYSA-N.
| Molecular formula | C24H18ClNO4 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | N-(4-chloro-3-methoxy-1-oxoisochromen-7-yl)-2,2-diphenylacetamide |
| InChIKey | VKHWNOVUTPMVHV-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C(C=C2)NC(=O)C(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O1)Cl |
Computed by PubChem (NCBI)