Products 1202400-17-6

CAS 1202400-17-6 is the registry number for N3-PEG(3)-NH-Suc. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid (CAS 1202400-17-6) is a chemical compound with the molecular formula C12H22N4O6 and a molecular weight of 318.33 g/mol. IUPAC name: 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid. InChIKey: IADGITLRTVYSJT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N4O6
Molecular weight318.33 g/mol
IUPAC name4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid
InChIKeyIADGITLRTVYSJT-UHFFFAOYSA-N
SMILESC(CC(=O)O)C(=O)NCCOCCOCCOCCN=[N+]=[N-]

Computed by PubChem (NCBI)