Products 1202404-23-6
CAS 1202404-23-6 is the registry number for Neuroinflammatory-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-chloro-2-methylphenyl)-7-methoxy-2,2-dimethylchromen-8-ol (CAS 1202404-23-6) is a chemical compound with the molecular formula C19H19ClO3 and a molecular weight of 330.8 g/mol. IUPAC name: 4-(4-chloro-2-methylphenyl)-7-methoxy-2,2-dimethylchromen-8-ol. InChIKey: WNNARDJCOGHFDX-UHFFFAOYSA-N.
| Molecular formula | C19H19ClO3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 4-(4-chloro-2-methylphenyl)-7-methoxy-2,2-dimethylchromen-8-ol |
| InChIKey | WNNARDJCOGHFDX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C2=CC(OC3=C2C=CC(=C3O)OC)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Neuroinflammatory-IN-3, orb1744945