CAS 1202564-31-5 appears in our catalog under these names: 2-Chlorodibenzo[f,h]quinoxaline, 95%, 2-Chlorodibenzo[f,h]quinoxaline, >97.0%(HPLC)(qNMR), 2-Chlorodibenzo[F,H]Quinoxaline, 97.0%, 97.0%, 2-CHLORODIBENZO[F,H]QUINOXALINE, 98%(GC-MS),RG. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 200mg.
3-chlorophenanthro[9,10-b]pyrazine (CAS 1202564-31-5) is a chemical compound with the molecular formula C16H9ClN2 and a molecular weight of 264.71 g/mol. IUPAC name: 3-chlorophenanthro[9,10-b]pyrazine. InChIKey: FEYJCWNQZBKYKT-UHFFFAOYSA-N.
| Molecular formula | C16H9ClN2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 3-chlorophenanthro[9,10-b]pyrazine |
| InChIKey | FEYJCWNQZBKYKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=NC(=CN=C24)Cl |
Computed by PubChem (NCBI)