CAS 1202681-04-6 appears in our catalog under these names: Mpeg5-azide, 95%, m–PEG5–azide, Mpeg5-n3 97%, 16-Azido-2,5,8,11,14-pentaoxahexadecane, 98%, 98%, m-PEG5-azide. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, 250 mg, 50 mg, 100 mg, 1 g.
1-azido-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethane (CAS 1202681-04-6) is a chemical compound with the molecular formula C11H23N3O5 and a molecular weight of 277.32 g/mol. IUPAC name: 1-azido-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethane. InChIKey: GRQHYZOCCBXIMP-UHFFFAOYSA-N.
| Molecular formula | C11H23N3O5 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 1-azido-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethane |
| InChIKey | GRQHYZOCCBXIMP-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)