CAS 1202757-89-8 appears in our catalog under these names: Spebrutinib/ 97.14% (existing batch purity), AVL–292, CC 292, Spebrutinib, 95%, Spebrutinib 98+%. Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 0,25g.
N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (CAS 1202757-89-8) is a chemical compound with the molecular formula C22H22FN5O3 and a molecular weight of 423.4 g/mol. IUPAC name: N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide. InChIKey: KXBDTLQSDKGAEB-UHFFFAOYSA-N.
| Molecular formula | C22H22FN5O3 |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| InChIKey | KXBDTLQSDKGAEB-UHFFFAOYSA-N |
| SMILES | COCCOC1=CC=C(C=C1)NC2=NC=C(C(=N2)NC3=CC(=CC=C3)NC(=O)C=C)F |
Computed by PubChem (NCBI)