CAS 120277-70-5 is the registry number for 3-(Bromomethyl)quinoline, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
3-(bromomethyl)quinoline (CAS 120277-70-5) is a chemical compound with the molecular formula C10H8BrN and a molecular weight of 222.08 g/mol. IUPAC name: 3-(bromomethyl)quinoline. InChIKey: XWWZTYWUMVMFNF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 3-(bromomethyl)quinoline |
| InChIKey | XWWZTYWUMVMFNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)CBr |
Computed by PubChem (NCBI)