CAS 120279-86-9 is the registry number for 5,6–DIHYDRO–6–METHYL–4–OXO–4H–THIENO(2,3–B)THIOPYRAN–2–SULFONIC ACIS. Offered by: GLPBio. Available pack sizes: 200mg.
6-methyl-4-oxo-5,6-dihydrothieno[2,3-b]thiopyran-2-sulfonic acid (CAS 120279-86-9) is a chemical compound with the molecular formula C8H8O4S3 and a molecular weight of 264.3 g/mol. IUPAC name: 6-methyl-4-oxo-5,6-dihydrothieno[2,3-b]thiopyran-2-sulfonic acid. InChIKey: URRUPLXHINNWCE-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S3 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 6-methyl-4-oxo-5,6-dihydrothieno[2,3-b]thiopyran-2-sulfonic acid |
| InChIKey | URRUPLXHINNWCE-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(S1)SC(=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)