CAS 120279-88-1 is the registry number for 6-Methyl-4-oxo-5,6-dihydro-4H-thieno(2,3-b)thiopyran-2-sulfonamide. Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
6-methyl-4-oxo-5,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide (CAS 120279-88-1) is a chemical compound with the molecular formula C8H9NO3S3 and a molecular weight of 263.4 g/mol. IUPAC name: 6-methyl-4-oxo-5,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide. InChIKey: QMNAQPMXDMLOLD-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S3 |
|---|---|
| Molecular weight | 263.4 g/mol |
| IUPAC name | 6-methyl-4-oxo-5,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide |
| InChIKey | QMNAQPMXDMLOLD-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(S1)SC(=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)