CAS 1202853-57-3 is the registry number for 5-(5-Carboxypyrimidin-2-yl)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-carboxypyrimidin-2-yl)benzene-1,3-dicarboxylic acid (CAS 1202853-57-3) is a chemical compound with the molecular formula C13H8N2O6 and a molecular weight of 288.21 g/mol. IUPAC name: 5-(5-carboxypyrimidin-2-yl)benzene-1,3-dicarboxylic acid. InChIKey: URHKHZGTXSZCAW-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O6 |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | 5-(5-carboxypyrimidin-2-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | URHKHZGTXSZCAW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)