CAS 1202865-37-9 appears in our catalog under these names: Hexanedioic-d8 Acid Dihydrazide, 98 atom % D, min 98% Chemical Purity, Adipic acid dihydrazide-d8, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10 mg, 1 mg, 5 mg.
2,2,3,3,4,4,5,5-octadeuteriohexanedihydrazide (CAS 1202865-37-9) is a chemical compound with the molecular formula C6H14N4O2 and a molecular weight of 182.25 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octadeuteriohexanedihydrazide. InChIKey: IBVAQQYNSHJXBV-SVYQBANQSA-N.
| Molecular formula | C6H14N4O2 |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octadeuteriohexanedihydrazide |
| InChIKey | IBVAQQYNSHJXBV-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C(=O)NN)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)NN |
Computed by PubChem (NCBI)