Products 1202879-00-2

CAS 1202879-00-2 is the registry number for 7-bromo-2-chloro-1,3-benzoxazole, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

7-bromo-2-chloro-1,3-benzoxazole (CAS 1202879-00-2) is a chemical compound with the molecular formula C7H3BrClNO and a molecular weight of 232.46 g/mol. IUPAC name: 7-bromo-2-chloro-1,3-benzoxazole. InChIKey: WDNICSHMKHFUKS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClNO
Molecular weight232.46 g/mol
IUPAC name7-bromo-2-chloro-1,3-benzoxazole
InChIKeyWDNICSHMKHFUKS-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Br)OC(=N2)Cl

Computed by PubChem (NCBI)