Products 1202936-50-2
CAS 1202936-50-2 appears in our catalog under these names: L-2-Aminopentanoic-4,4,5,5,5-d5 Acid, 98 atom % D, min 98% Chemical Purity, L-Norvaline-d5, 99.9%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 10 mg, 1 mg.
(2S)-2-amino-4,4,5,5,5-pentadeuteriopentanoic acid (CAS 1202936-50-2) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 122.18 g/mol. IUPAC name: (2S)-2-amino-4,4,5,5,5-pentadeuteriopentanoic acid. InChIKey: SNDPXSYFESPGGJ-JWUQSEDQSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 122.18 g/mol |
| IUPAC name | (2S)-2-amino-4,4,5,5,5-pentadeuteriopentanoic acid |
| InChIKey | SNDPXSYFESPGGJ-JWUQSEDQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)