CAS 120298-11-5 appears in our catalog under these names: 1-(5-(Trifluoromethyl)pyridin-2-yl)piperazine dihydrochloride, 95%, 1-(5-(Trifluoromethyl)pyridin-2-yl)piperazine dihydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
1-[5-(trifluoromethyl)-2-pyridinyl]piperazine;dihydrochloride (CAS 120298-11-5) is a chemical compound with the molecular formula C10H14Cl2F3N3 and a molecular weight of 304.14 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-2-pyridinyl]piperazine;dihydrochloride. InChIKey: BZIQAQCLPNZFMH-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2F3N3 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-2-pyridinyl]piperazine;dihydrochloride |
| InChIKey | BZIQAQCLPNZFMH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=C(C=C2)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)