CAS 1203-68-5 appears in our catalog under these names: Biphenyl–2–carboxaldehyde, [1,1'-Biphenyl]-2-carboxaldehyde, >98.0%(GC), [1,1'-Biphenyl]-2-carbaldehyde 97%, 2-Biphenylcarboxaldehyde, 97%, 97%, 2-Biphenylcarboxaldehyde, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
2-phenylbenzaldehyde (CAS 1203-68-5) is a chemical compound with the molecular formula C13H10O and a molecular weight of 182.22 g/mol. IUPAC name: 2-phenylbenzaldehyde. InChIKey: LCRCBXLHWTVPEQ-UHFFFAOYSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-phenylbenzaldehyde |
| InChIKey | LCRCBXLHWTVPEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)