CAS 1203-87-8 appears in our catalog under these names: 2-(Methylthio)-7H-purin-6-amine, 97%, 5-H-Amiloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 1mg.
3-amino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide (CAS 1203-87-8) is a chemical compound with the molecular formula C6H7ClN6O and a molecular weight of 214.61 g/mol. IUPAC name: 3-amino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide. InChIKey: PTIMHPOSZRUADS-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN6O |
|---|---|
| Molecular weight | 214.61 g/mol |
| IUPAC name | 3-amino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide |
| InChIKey | PTIMHPOSZRUADS-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)N)C(=O)N=C(N)N)Cl |
Computed by PubChem (NCBI)