Products 120307-06-4

CAS 120307-06-4 is the registry number for Tetrabutylammonium butyltriphenylborate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

Butyl(triphenyl)boranuide;tetrabutylazanium (CAS 120307-06-4) is a chemical compound with the molecular formula C38H60BN and a molecular weight of 541.7 g/mol. IUPAC name: butyl(triphenyl)boranuide;tetrabutylazanium. InChIKey: CEZMKTBVLJODAE-UHFFFAOYSA-N.

Identity
Molecular formulaC38H60BN
Molecular weight541.7 g/mol
IUPAC namebutyl(triphenyl)boranuide;tetrabutylazanium
InChIKeyCEZMKTBVLJODAE-UHFFFAOYSA-N
SMILES[B-](CCCC)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.CCCC[N+](CCCC)(CCCC)CCCC

Computed by PubChem (NCBI)