CAS 120307-06-4 is the registry number for Tetrabutylammonium butyltriphenylborate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
Butyl(triphenyl)boranuide;tetrabutylazanium (CAS 120307-06-4) is a chemical compound with the molecular formula C38H60BN and a molecular weight of 541.7 g/mol. IUPAC name: butyl(triphenyl)boranuide;tetrabutylazanium. InChIKey: CEZMKTBVLJODAE-UHFFFAOYSA-N.
| Molecular formula | C38H60BN |
|---|---|
| Molecular weight | 541.7 g/mol |
| IUPAC name | butyl(triphenyl)boranuide;tetrabutylazanium |
| InChIKey | CEZMKTBVLJODAE-UHFFFAOYSA-N |
| SMILES | [B-](CCCC)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.CCCC[N+](CCCC)(CCCC)CCCC |
Computed by PubChem (NCBI)