Products 1203212-36-5
CAS 1203212-36-5 is the registry number for 1-Ethyl-3,7-dimethyl-8-sulfanyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-ethyl-3,7-dimethyl-8-sulfanylidene-9H-purine-2,6-dione (CAS 1203212-36-5) is a chemical compound with the molecular formula C9H12N4O2S and a molecular weight of 240.28 g/mol. IUPAC name: 1-ethyl-3,7-dimethyl-8-sulfanylidene-9H-purine-2,6-dione. InChIKey: STSHACDJOZRALQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 1-ethyl-3,7-dimethyl-8-sulfanylidene-9H-purine-2,6-dione |
| InChIKey | STSHACDJOZRALQ-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(NC(=S)N2C)N(C1=O)C |
Computed by PubChem (NCBI)