CAS 120330-44-1 is the registry number for Citroside A. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
Citroside B is a member of allenes and a terpene glycoside. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C19H30O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 4-[(4S,6R)-4-hydroxy-2,2,6-trimethyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]but-3-en-2-one |
| InChIKey | XTODSGVDHGMKSN-SIEIHWOKSA-N |
| SMILES | CC(=O)C=C=C1[C@](C[C@H](CC1(C)C)O)(C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)