CAS 1203360-94-4 is the registry number for 6-Chloro-2-pyridin-2-ylquinoline-4-carbonyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
6-chloro-2-pyridin-2-ylquinoline-4-carbonyl chloride (CAS 1203360-94-4) is a chemical compound with the molecular formula C15H8Cl2N2O and a molecular weight of 303.1 g/mol. IUPAC name: 6-chloro-2-pyridin-2-ylquinoline-4-carbonyl chloride. InChIKey: AYNIYAKUHVCKJO-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2N2O |
|---|---|
| Molecular weight | 303.1 g/mol |
| IUPAC name | 6-chloro-2-pyridin-2-ylquinoline-4-carbonyl chloride |
| InChIKey | AYNIYAKUHVCKJO-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)Cl |
Computed by PubChem (NCBI)