CAS 12034-88-7 appears in our catalog under these names: Lead(II) niobate/ 99.9% (SVHC listed - EVE/EUD), Lead(II) niobate, 99.9%. Offered by: Chemat. Available pack sizes: 50g.
(dioxoniobiooxy-lambda2-plumbanyl)oxy-dioxoniobium (CAS 12034-88-7) is a chemical compound with the molecular formula Nb2O6Pb and a molecular weight of 489 g/mol. IUPAC name: (dioxoniobiooxy-lambda2-plumbanyl)oxy-dioxoniobium. InChIKey: HJQKHVBXBQZGBY-UHFFFAOYSA-N.
| Molecular formula | Nb2O6Pb |
|---|---|
| Molecular weight | 489 g/mol |
| IUPAC name | (dioxoniobiooxy-lambda2-plumbanyl)oxy-dioxoniobium |
| InChIKey | HJQKHVBXBQZGBY-UHFFFAOYSA-N |
| SMILES | O=[Nb](=O)O[Pb]O[Nb](=O)=O |
Computed by PubChem (NCBI)