CAS 1203499-15-3 is the registry number for 6-Allyl-2-(trimethylsilyl)furo[3,2-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Trimethyl-(6-prop-2-enylfuro[3,2-b]pyridin-2-yl)silane (CAS 1203499-15-3) is a chemical compound with the molecular formula C13H17NOSi and a molecular weight of 231.36 g/mol. IUPAC name: trimethyl-(6-prop-2-enylfuro[3,2-b]pyridin-2-yl)silane. InChIKey: KSIXFIRSSFJEIB-UHFFFAOYSA-N.
| Molecular formula | C13H17NOSi |
|---|---|
| Molecular weight | 231.36 g/mol |
| IUPAC name | trimethyl-(6-prop-2-enylfuro[3,2-b]pyridin-2-yl)silane |
| InChIKey | KSIXFIRSSFJEIB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=C(O1)C=C(C=N2)CC=C |
Computed by PubChem (NCBI)