CAS 1203565-82-5 appears in our catalog under these names: 1H-Pyrrolo[2,3-b]pyridine-1-carboxylic acid, 4-chloro-3-iodo-, 1,1-dimethylethyl ester, 98%, 98%, 1H-Pyrrolo[2,3-b]pyridine-1-carboxylic acid, 4-chloro-3-iodo-, 1,1-dimethylethyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Tert-butyl 4-chloro-3-iodopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1203565-82-5) is a chemical compound with the molecular formula C12H12ClIN2O2 and a molecular weight of 378.59 g/mol. IUPAC name: tert-butyl 4-chloro-3-iodopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: XOBTXIFYRZGVRQ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClIN2O2 |
|---|---|
| Molecular weight | 378.59 g/mol |
| IUPAC name | tert-butyl 4-chloro-3-iodopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | XOBTXIFYRZGVRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C(C=CN=C21)Cl)I |
Computed by PubChem (NCBI)