CAS 120360-51-2 appears in our catalog under these names: 4,4',4''-((Benzene-1,3,5-tricarbonyl)tris(azanediyl))tribenzoic acid, 97%, 97%, 4,4',4''-((Benzene-1,3,5-tricarbonyl)tris(azanediyl))tribenzoic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[[3,5-bis[(4-carboxyphenyl)carbamoyl]benzoyl]amino]benzoic acid (CAS 120360-51-2) is a chemical compound with the molecular formula C30H21N3O9 and a molecular weight of 567.5 g/mol. IUPAC name: 4-[[3,5-bis[(4-carboxyphenyl)carbamoyl]benzoyl]amino]benzoic acid. InChIKey: GMWRYUDJCZXIDN-UHFFFAOYSA-N.
| Molecular formula | C30H21N3O9 |
|---|---|
| Molecular weight | 567.5 g/mol |
| IUPAC name | 4-[[3,5-bis[(4-carboxyphenyl)carbamoyl]benzoyl]amino]benzoic acid |
| InChIKey | GMWRYUDJCZXIDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)C2=CC(=CC(=C2)C(=O)NC3=CC=C(C=C3)C(=O)O)C(=O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)