CAS 1203609-10-2 is the registry number for 2-(cis-4-(4-Chlorophenyl)cyclohexyl)-1,4-naphthalenedione (Major). Offered by: TRC. Available pack sizes: 25mg.
2-[4-(4-chlorophenyl)cyclohexyl]naphthalene-1,4-dione (CAS 1203609-10-2) is a chemical compound with the molecular formula C22H19ClO2 and a molecular weight of 350.8 g/mol. IUPAC name: 2-[4-(4-chlorophenyl)cyclohexyl]naphthalene-1,4-dione. InChIKey: CHXRCCJFHHYDBA-UHFFFAOYSA-N.
| Molecular formula | C22H19ClO2 |
|---|---|
| Molecular weight | 350.8 g/mol |
| IUPAC name | 2-[4-(4-chlorophenyl)cyclohexyl]naphthalene-1,4-dione |
| InChIKey | CHXRCCJFHHYDBA-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C3=CC(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)