CAS 1203709-19-6 is the registry number for 2-Bromo-1-(5-fluoropyridin-3-yl)ethan-1-one hydrobromide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-1-(5-fluoro-3-pyridinyl)ethanone;hydrobromide (CAS 1203709-19-6) is a chemical compound with the molecular formula C7H6Br2FNO and a molecular weight of 298.93 g/mol. IUPAC name: 2-bromo-1-(5-fluoro-3-pyridinyl)ethanone;hydrobromide. InChIKey: PWLCWYMDYCCCLL-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2FNO |
|---|---|
| Molecular weight | 298.93 g/mol |
| IUPAC name | 2-bromo-1-(5-fluoro-3-pyridinyl)ethanone;hydrobromide |
| InChIKey | PWLCWYMDYCCCLL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1F)C(=O)CBr.Br |
Computed by PubChem (NCBI)