Products 1203852-75-8
CAS 1203852-75-8 is the registry number for Ethyl 1-(2-(methoxycarbonyl)-4-nitrophenyl)-5-methyl-1h-imidazole-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Ethyl 1-(2-methoxycarbonyl-4-nitrophenyl)-5-methylimidazole-4-carboxylate (CAS 1203852-75-8) is a chemical compound with the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. IUPAC name: ethyl 1-(2-methoxycarbonyl-4-nitrophenyl)-5-methylimidazole-4-carboxylate. InChIKey: GHWRXCNCMVAHGG-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O6 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | ethyl 1-(2-methoxycarbonyl-4-nitrophenyl)-5-methylimidazole-4-carboxylate |
| InChIKey | GHWRXCNCMVAHGG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C=N1)C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)OC)C |
Computed by PubChem (NCBI)