Products 120398-50-7
CAS 120398-50-7 appears in our catalog under these names: N-2-(Hydroxyethyl)-L-valine-d4 (Technical grade), N-2-(Hydroxyethyl)-L-valine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
3-methyl-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]butanoic acid (CAS 120398-50-7) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 165.22 g/mol. IUPAC name: 3-methyl-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]butanoic acid. InChIKey: AJNYQRXDVGKEIT-KHORGVISSA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 165.22 g/mol |
| IUPAC name | 3-methyl-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]butanoic acid |
| InChIKey | AJNYQRXDVGKEIT-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NC(C(C)C)C(=O)O |
Computed by PubChem (NCBI)