CAS 1204-28-0 appears in our catalog under these names: Trimellitic anhydride chloride, Trimellitic anhydride chloride, 98% , Trimellitic Anhydride Chloride, >98.0%(GC)(T), 1,3-Dioxo-1,3-dihydroisobenzofuran-5-carbonyl chloride 98%, Trimellitic Anhydride Chloride, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 500g, 25g, 10g.
1,3-dioxo-2-benzofuran-5-carbonyl chloride (CAS 1204-28-0) is a chemical compound with the molecular formula C9H3ClO4 and a molecular weight of 210.57 g/mol. IUPAC name: 1,3-dioxo-2-benzofuran-5-carbonyl chloride. InChIKey: NJMOHBDCGXJLNJ-UHFFFAOYSA-N.
| Molecular formula | C9H3ClO4 |
|---|---|
| Molecular weight | 210.57 g/mol |
| IUPAC name | 1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| InChIKey | NJMOHBDCGXJLNJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)Cl)C(=O)OC2=O |
Computed by PubChem (NCBI)