Products 1204144-28-4
CAS 1204144-28-4 appears in our catalog under these names: AZD1208, AZD1208, >95% (HPLC), AZD1208/ 97.24% (existing batch purity), AZD 1208, AZD-1208. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 250mg, 50mg, 2mg, 5mg, 25mg, 100mg.
(5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-phenylphenyl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 1204144-28-4) is a chemical compound with the molecular formula C21H21N3O2S and a molecular weight of 379.5 g/mol. IUPAC name: (5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-phenylphenyl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: MCUJKPPARUPFJM-UWCCDQBKSA-N.
| Molecular formula | C21H21N3O2S |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | (5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-phenylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | MCUJKPPARUPFJM-UWCCDQBKSA-N |
| SMILES | C1C[C@H](CN(C1)C2=C(C=CC=C2C3=CC=CC=C3)/C=C\4/C(=O)NC(=O)S4)N |
Computed by PubChem (NCBI)