Products 1204234-81-0
CAS 1204234-81-0 appears in our catalog under these names: 3-(Trifluoromethylthio)pyridin-2-amine, 95%, 3–((Trifluoromethyl)thio)pyridin–2–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
3-(trifluoromethylsulfanyl)pyridin-2-amine (CAS 1204234-81-0) is a chemical compound with the molecular formula C6H5F3N2S and a molecular weight of 194.18 g/mol. IUPAC name: 3-(trifluoromethylsulfanyl)pyridin-2-amine. InChIKey: HGWRAVLHAIJDSQ-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2S |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-(trifluoromethylsulfanyl)pyridin-2-amine |
| InChIKey | HGWRAVLHAIJDSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N)SC(F)(F)F |
Computed by PubChem (NCBI)