CAS 1204298-60-1 appears in our catalog under these names: 3-Bromo-5-methoxy-1h-pyrrolo[2,3-c]pyridine, 98%, 3-Bromo-5-methoxy-1H-pyrrolo[2,3-c]pyridine 97%, 3-bromo-5-methoxy-1H-pyrrolo[2,3-c]pyridine, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 2.5g.
3-bromo-5-methoxy-1H-pyrrolo[2,3-c]pyridine (CAS 1204298-60-1) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 3-bromo-5-methoxy-1H-pyrrolo[2,3-c]pyridine. InChIKey: HSLZMAWJHILVMP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 3-bromo-5-methoxy-1H-pyrrolo[2,3-c]pyridine |
| InChIKey | HSLZMAWJHILVMP-UHFFFAOYSA-N |
| SMILES | COC1=NC=C2C(=C1)C(=CN2)Br |
Computed by PubChem (NCBI)