Products 1204334-20-2
CAS 1204334-20-2 is the registry number for 3,5-Bis(trifluoromethyl)-1H-pyrazole-4-boronic acid pinacol ester, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 500mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5-bis(trifluoromethyl)-1H-pyrazole (CAS 1204334-20-2) is a chemical compound with the molecular formula C11H13BF6N2O2 and a molecular weight of 330.04 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5-bis(trifluoromethyl)-1H-pyrazole. InChIKey: CLZOYAKINXVSHM-UHFFFAOYSA-N.
| Molecular formula | C11H13BF6N2O2 |
|---|---|
| Molecular weight | 330.04 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5-bis(trifluoromethyl)-1H-pyrazole |
| InChIKey | CLZOYAKINXVSHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(NN=C2C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)