CAS 1204518-35-3 is the registry number for 1-Methylethyl 2-Amino-4-methyl-5-(4-(trifluoromethoxy)phenoxy)benzoate. Offered by: TRC. Available pack sizes: 1g.
Propan-2-yl 2-amino-4-methyl-5-[4-(trifluoromethoxy)phenoxy]benzoate (CAS 1204518-35-3) is a chemical compound with the molecular formula C18H18F3NO4 and a molecular weight of 369.3 g/mol. IUPAC name: propan-2-yl 2-amino-4-methyl-5-[4-(trifluoromethoxy)phenoxy]benzoate. InChIKey: GESQWEAXWPPZBJ-UHFFFAOYSA-N.
| Molecular formula | C18H18F3NO4 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | propan-2-yl 2-amino-4-methyl-5-[4-(trifluoromethoxy)phenoxy]benzoate |
| InChIKey | GESQWEAXWPPZBJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC2=CC=C(C=C2)OC(F)(F)F)C(=O)OC(C)C)N |
Computed by PubChem (NCBI)