CAS 1204520-60-4 is the registry number for (4-(tert-Butoxy)phenyl)trimethoxysilane, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Trimethoxy-[4-[(2-methylpropan-2-yl)oxy]phenyl]silane (CAS 1204520-60-4) is a chemical compound with the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. IUPAC name: trimethoxy-[4-[(2-methylpropan-2-yl)oxy]phenyl]silane. InChIKey: TYFCBCGVPFSASH-UHFFFAOYSA-N.
| Molecular formula | C13H22O4Si |
|---|---|
| Molecular weight | 270.40 g/mol |
| IUPAC name | trimethoxy-[4-[(2-methylpropan-2-yl)oxy]phenyl]silane |
| InChIKey | TYFCBCGVPFSASH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)[Si](OC)(OC)OC |
Computed by PubChem (NCBI)