CAS 1204572-46-2 is the registry number for AMPA receptor modulator-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,7-dichloro-4-cyclopropyl-2,3-dihydro-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 1204572-46-2) is a chemical compound with the molecular formula C10H10Cl2N2O2S and a molecular weight of 293.17 g/mol. IUPAC name: 6,7-dichloro-4-cyclopropyl-2,3-dihydro-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: RQWQTTDKAIAANG-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O2S |
|---|---|
| Molecular weight | 293.17 g/mol |
| IUPAC name | 6,7-dichloro-4-cyclopropyl-2,3-dihydro-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | RQWQTTDKAIAANG-UHFFFAOYSA-N |
| SMILES | C1CC1N2CNS(=O)(=O)C3=CC(=C(C=C32)Cl)Cl |
Computed by PubChem (NCBI)