CAS 1204572-81-5 is the registry number for 4-Bromo-3-chloro-2-fluorobenzenesulfonamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-3-chloro-2-fluorobenzenesulfonamide (CAS 1204572-81-5) is a chemical compound with the molecular formula C6H4BrClFNO2S and a molecular weight of 288.52 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzenesulfonamide. InChIKey: NQHLPDSDGOCFQU-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClFNO2S |
|---|---|
| Molecular weight | 288.52 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzenesulfonamide |
| InChIKey | NQHLPDSDGOCFQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1S(=O)(=O)N)F)Cl)Br |
Computed by PubChem (NCBI)