CAS 1204688-16-3 is the registry number for Norsufentanil–d3. Offered by: GLPBio. Available pack sizes: 500μg, 1mg, 5mg.
N-phenyl-N-[4-(trideuteriomethoxymethyl)piperidin-4-yl]propanamide (CAS 1204688-16-3) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 279.39 g/mol. IUPAC name: N-phenyl-N-[4-(trideuteriomethoxymethyl)piperidin-4-yl]propanamide. InChIKey: ULOZGJWEIWAWML-BMSJAHLVSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 279.39 g/mol |
| IUPAC name | N-phenyl-N-[4-(trideuteriomethoxymethyl)piperidin-4-yl]propanamide |
| InChIKey | ULOZGJWEIWAWML-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OCC1(CCNCC1)N(C2=CC=CC=C2)C(=O)CC |
Computed by PubChem (NCBI)