CAS 1204809-88-0 appears in our catalog under these names: Exo-8-boc-8-azabicyclo[3.2.1]octane-3-carboxylic acid methyl ester, 97%, 8-tert-Butyl 3-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate, 95%, 8-(tert-Butyl) 3-methyl 8-azabicyclo(3.2.1)octane-3,8-dicarboxylate, 97%, 8-(tert-Butyl) 3-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate 95%, 8-Azabicyclo[3.2.1]octane-3,8-dicarboxylic acid, 8-(1,1-dimethylethyl) 3-methyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100mg, 500mg.
8-O-tert-butyl 3-O-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate (CAS 1204809-88-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate. InChIKey: AMBCTFGOVMCGIL-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate |
| InChIKey | AMBCTFGOVMCGIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(C2)C(=O)OC |
Computed by PubChem (NCBI)