CAS 1204811-37-9 appears in our catalog under these names: 3-Bromo-4,5,7-trichloroquinoline, 95%, 3-Bromo-4,5,7-trichloroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-bromo-4,5,7-trichloroquinoline (CAS 1204811-37-9) is a chemical compound with the molecular formula C9H3BrCl3N and a molecular weight of 311.4 g/mol. IUPAC name: 3-bromo-4,5,7-trichloroquinoline. InChIKey: VGQJCRJFTCKEFT-UHFFFAOYSA-N.
| Molecular formula | C9H3BrCl3N |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 3-bromo-4,5,7-trichloroquinoline |
| InChIKey | VGQJCRJFTCKEFT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(C(=CN=C21)Br)Cl)Cl)Cl |
Computed by PubChem (NCBI)