Products 120550-35-8
CAS 120550-35-8 appears in our catalog under these names: Biotin-OPFP, 95%, Biotin–PFP ester, Biotin-PFP, Biotin Pentafluorophenyl Ester, >97.0%(HPLC), (+)-Biotin-PFP-ester. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 25g, 50mg, 250 mg.
(2,3,4,5,6-pentafluorophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (CAS 120550-35-8) is a chemical compound with the molecular formula C16H15F5N2O3S and a molecular weight of 410.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate. InChIKey: DKTMDBQDSYQUEV-LEJLMFORSA-N.
| Molecular formula | C16H15F5N2O3S |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| InChIKey | DKTMDBQDSYQUEV-LEJLMFORSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)OC3=C(C(=C(C(=C3F)F)F)F)F)NC(=O)N2 |
Computed by PubChem (NCBI)