CAS 1205548-03-3 is the registry number for 4'-Dimethylamino 7,8-Dihydroxyflavone Dimethyl Ether, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide (CAS 1205548-03-3) is a chemical compound with the molecular formula C19H20BrNO4 and a molecular weight of 406.3 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide. InChIKey: XQSSTERYBODMAJ-UHFFFAOYSA-N.
| Molecular formula | C19H20BrNO4 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide |
| InChIKey | XQSSTERYBODMAJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3)OC)OC.Br |
Computed by PubChem (NCBI)