Products 1205963-04-7
CAS 1205963-04-7 is the registry number for sEH inhibitor-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-N-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide (CAS 1205963-04-7) is a chemical compound with the molecular formula C21H14ClN3O2 and a molecular weight of 375.8 g/mol. IUPAC name: 4-chloro-N-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide. InChIKey: ZMGCURBWDWWYCQ-UHFFFAOYSA-N.
| Molecular formula | C21H14ClN3O2 |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | 4-chloro-N-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide |
| InChIKey | ZMGCURBWDWWYCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)C3=CC=C(C=C3)NC(=O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
sEH inhibitor-6, orb1688495