Products 1206185-52-5
CAS 1206185-52-5 appears in our catalog under these names: Levulinic acid–d5, Levulinic-d5 Acid, >95% (GC), Levulinic-3,3,5,5,5-d5 Acid, 98 atom % D, min 98% Chemical Purity, Levulinic-d5 acid, Levulinic acid-d5, 99.01%. Offered by: GLPBio, TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 5mg, 2,5mg, 25mg, 0,1g, 0,05g, 10mg, 50mg, 100mg.
3,3,5,5,5-pentadeuterio-4-oxopentanoic acid (CAS 1206185-52-5) is a chemical compound with the molecular formula C5H8O3 and a molecular weight of 121.15 g/mol. IUPAC name: 3,3,5,5,5-pentadeuterio-4-oxopentanoic acid. InChIKey: JOOXCMJARBKPKM-ZBJDZAJPSA-N.
| Molecular formula | C5H8O3 |
|---|---|
| Molecular weight | 121.15 g/mol |
| IUPAC name | 3,3,5,5,5-pentadeuterio-4-oxopentanoic acid |
| InChIKey | JOOXCMJARBKPKM-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC(=O)O |
Computed by PubChem (NCBI)