CAS 1206629-08-4 appears in our catalog under these names: TUG-499, 98%, TUG-499/ 99.59% (existing batch purity), TUG–499, TUG-499, TUG-499, 99.78%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 25mg, 10mg, 50mg, 100mg, 500mg, 25 mg.
3-[4-[2-(2,6-dichloro-4-pyridinyl)ethynyl]phenyl]propanoic acid (CAS 1206629-08-4) is a chemical compound with the molecular formula C16H11Cl2NO2 and a molecular weight of 320.2 g/mol. IUPAC name: 3-[4-[2-(2,6-dichloro-4-pyridinyl)ethynyl]phenyl]propanoic acid. InChIKey: GCWBKYDSSJIRNJ-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2NO2 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | 3-[4-[2-(2,6-dichloro-4-pyridinyl)ethynyl]phenyl]propanoic acid |
| InChIKey | GCWBKYDSSJIRNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)O)C#CC2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)